(+)-Isopulegol
Isopulegol is a monoterpene alcohol, which is generally found in essential oils of various plants. It is widely used as a fragrance ingredient in cosmetics, shampoos and toilet soaps. Isopulegol is also a key intermediate in the synthesis of (?)-menthol.
| Catalog Number | CBB1117089 |
| Alternative Name(s) | (1S,3S,4R)-p-Menth-8-en-3-ol; (1S,2R,5S)-2-Isopropenyl-5-methylcyclohexanol |
| Molecular Formula | C10H18O |
| CAS# | 104870-56-6 |
| Purity | >99% |
| Inchi | 1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m0/s1 |
| Inchi Key | ZYTMANIQRDEHIO-AEJSXWLSSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@@H](O)C1)C(C)=C |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/isopulegol-item-117089.html |
