(+)-6-Aminopenicillanic acid
Chemical structure: ?-lactam(+)-6-Aminopenicillanic acid is the core moiety of different penicillins. It can be prepared from the benzylpenicillin silyl ester via cleavage of the amide bond. The coating of (+)-6-aminopenicillanic acid on silver nanoparticles (6APA-AgNPs), imparts them with an ability to detect chromium (IV) in human erythrocytes.
| Catalog Number | CBB1113079 |
| Alternative Name(s) | 6-APA; (2S,5R,6R)-6-Amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Molecular Formula | C8H12N2O3S |
| CAS# | 551-16-6 |
| Purity | >96% |
| Inchi | 1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| Inchi Key | NGHVIOIJCVXTGV-ALEPSDHESA-N |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(O)=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/6-aminopenicillanic-acid-item-113079.html |