Potassium trifluoromethanesulfonate
Potassium trifluoromethanesulfonate (KOTf, potassium triflate) is the potassium salt of trifluoromethanesulphonic acid. It has been prepared by neutralizing a warm aqueous solution of trifluoromethanesulphonic acid with potassium carbonate. The structure of siloxane–poly(oxyethylene) hybrids doped with potassium triflate has been investigated.
| Catalog Number | CBB1112488 |
| Alternative Name(s) | Potassium triflate; Trifluoromethanesulfonic acid potassium salt |
| Molecular Formula | CF3SO3K |
| CAS# | 2926-27-4 |
| Purity | >98% |
| Inchi | 1S/CHF3O3S.K/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
| Inchi Key | GLGXXYFYZWQGEL-UHFFFAOYSA-M |
| SMILES | [K+].[O-]S(=O)(=O)C(F)(F)F |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/potassium-trifluoromethanesulfonate-item-112488.html |