(3,4-dimethoxyphenyl)methanol-[13C]
(3,4-dimethoxyphenyl)methanol-[13C] is the labelled analogue of (3,4-dimethoxyphenyl)methanol (Verapamil Impurity E), which is a metabolite of some lignin degrading fungi. Studies shows that Verapamil Impurity E could be used as the fuel of the microbial fuel cell (MFC) to generate power.
| Catalog Number | BLP-002667 |
| Alternative Name(s) | 3,4-Dimethoxy[7-13C]-benzyl Alcohol |
| Molecular Formula | C8[13C]H12O3 |
| CAS# | 91384-88-2 |
| Purity | >98% |
| Inchi | InChI=1S/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3/i6+1 |
| Inchi Key | OEGPRYNGFWGMMV-PTQBSOBMSA-N |
| Size | Please inquire |
| Supplier Page | https://isotope.bocsci.com/product/3-4-dimethoxyphenyl-methanol-13c-cas-91384-88-2-347622.html |