(2S)-4-(Acetyloxy)-1,3-dioxolane-2-methanol Benzoate
(2S)-4-(Acetyloxy)-1,3-dioxolane-2-methanol Benzoate is an intermediate used in the synthesis of Troxacitabine (T805580), which is a nucleoside analogue with potential anticancer activity. Troxacitabine have been studied in patients with refractory lymphoproliferative diseases.
| Catalog Number | BB075419 |
| Alternative Name(s) | Benzoic acid(S)-4-acetoxy-[1,3]dioxolan-2-ylmethyl ester; 1,3-Dioxolane-2-methanol, 4-(acetyloxy)-, 2-benzoate, (2S)-; Benzoic acid 4(R,S)-acetoxy-[1,3]dioxolan- 2(S)-ylmethyl ester |
| Molecular Formula | C13H14O6 |
| CAS# | 214273-21-9 |
| Inchi | InChI=1S/C13H14O6/c1-9(14)18-12-8-16-11(19-12)7-17-13(15)10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3/t11-,12?/m0/s1 |
| Inchi Key | HZFOOXNVWXVDJP-PXYINDEMSA-N |
| Size | Please inquire |
| Supplier Page | https://buildingblock.bocsci.com/product/2s-4-acetyloxy-1-3-dioxolane-2-methanol-cas-214273-21-9-408315.html |
