(4-Chloro-3,5-dimethylpyridin-2-yl)methanol Hydrochloride
(4-Chloro-3,5-dimethylpyridin-2-yl)methanol Hydrochloride is a derivative of pyridine hydrochloride (P991280), a base structure present in many biologically active compounds like the vitamins niacin and pyridoxal. Pyridine is used in dehalogenation reactions and can be used as a base in condensation reactions.
| Catalog Number | BB055550 |
| Alternative Name(s) | 4-Chloro-3,5-dimethyl-2-pyridinemethanol Hydrochloride |
| Molecular Formula | C8H11Cl2NO |
| CAS# | 143016-70-0 |
| Inchi | InChI=1S/C8H10ClNO.ClH/c1-5-3-10-7(4-11)6(2)8(5)9/h3,11H,4H2,1-2H31H |
| Inchi Key | IXMKIVZVJKYQTR-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://buildingblock.bocsci.com/product/4-chloro-3-5-dimethylpyridin-2-yl-methanol-cas-143016-70-0-388467.html |