(2’R)-2′-deoxy-2′-fluoro-2′-C-methyluridine
PSI-6206 is a selective HCV RNA polymerase inhibitor. It is the unphosphorylated parent compound of triphosphate analog PSI-7409, which is a potent inhibitor of the HCV NS5B RNA dependent RNA polymerase.
| Catalog Number | B2693-459960 |
| Alternative Name(s) | RO-2433; RO 2433; RO2433; PSI6206; PSI 6206; PSI-6206; GS331007; GS-331007; GS 331007; 2'-Deoxy-2'-fluoro-2'-C-methyluridine; Sofosbuvir Metabolite GS331007; 1-((2R,3R,4R,5R)-3-Fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Molecular Formula | C10H13FN2O5 |
| CAS# | 863329-66-2 |
| Purity | ≥95% |
| Inchi | InChI=1S/C10H13FN2O5/c1-10(11)7(16)5(4-14)18-8(10)13-3-2-6(15)12-9(13)17/h2-3,5,7-8,14,16H,4H2,1H3,(H,12,15,17)/t5-,7-,8-,10-/m1/s1 |
| Inchi Key | ARKKGZQTGXJVKW-VPCXQMTMSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/product/2-r-2-deoxy-2-fluoro-2-c-methyluridine-cas-863329-66-2-459960.html |