β-Aspartylaspartic acid
An impurity of L-Ornithine L-aspartate salt which is used as a ligand in targeting SDF-1/CXCL12 with ligands that prevents activation of CXCR4 through structure-based drug design.
| Catalog Number | 60079-22-3 |
| Alternative Name(s) | Ornithine aspartate-2; Ornithine aspartate impurity B; L-Ornithine L-Aspartate Impurity 2; beta-Asp-Asp; (2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]butanedioic acid; ((S)-3-amino-3-carboxypropanoyl)-L-aspartic acid |
| Molecular Formula | C8H12N2O7 |
| CAS# | 60079-22-3 |
| Inchi | InChI=1S/C8H12N2O7/c9-3(7(14)15)1-5(11)10-4(8(16)17)2-6(12)13/h3-4H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| Inchi Key | KXAWLANLJYMEGB-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://aapep.bocsci.com/product/aspartylaspartic-acid-cas-60079-22-3-356775.html |