(+/-)-Epinephrine Hydrochloride
(±)-Epinephrine is a natural neurotransmitter that is released from the adrenal medulla and activates adrenoceptors (Kis = 15, 735, and 3,970 nM for α1A-, β2-, and β1-adrenergic receptors, respectively). (±)-Epinephrine hydrochloride is an adrenergic receptor agonist.
| Catalog Number | 329-63-5 |
| Alternative Name(s) | 4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol Hydrochloride; (±)-4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol Hydrochloride; 3,4-Dihydroxy-α-[(methylamino)methyl]-benzyl Alcohol Hydrochloride; (±)-Adrenaline Hydrochloride; Asthmanefrin; Racepinephrine Hydrochloride; Vaponefrin; dl-Adrenaline Hydrochloride; dl-Epinephrine Hydrochloride |
| Molecular Formula | C9H14ClNO3 |
| CAS# | 329-63-5 |
| Purity | ≥95% |
| Inchi | InChI=1S/C9H13NO3.ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,9-13H,5H2,1H3;1H |
| Inchi Key | ATADHKWKHYVBTJ-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/product/epinephrine-hydrochloride-cas-329-63-5-16953.html |