(+)-PD 128907 hydrochloride
(+)-PD 128907 hydrochloride, the more active enantiomer of trans-(±)-PD 128907, is a potent D3 dopamine receptor agonist (Ki = 2.3 nM), with 18-200-fold selectivity over other dopamine receptor subtypes.
| Catalog Number | 300576-59-4 |
| Alternative Name(s) | (4aR,10bR)-3,4a,4,10b-Tetrahydro-4-propyl-2H,5H-[1]benzopyrano-[4,3-b]-1,4-oxazin-9-ol hydrochloride; (+)-PD 128907 HCl; (+)-PD-128907 HCl; (+)-PD128907 HCl; (+)-PD128907 hydrochloride; (+)-PD-128907 hydrochloride; (+)-PD 128907 hydrochloride; PBPO; PBTO |
| Molecular Formula | C14H19NO3.HCl |
| CAS# | 300576-59-4 |
| Purity | ≥99% |
| Inchi | InChI=1S/C14H19NO3.ClH/c1-2-5-15-6-7-17-14-11-8-10(16)3-4-13(11)18-9-12(14)15;/h3-4,8,12,14,16H,2,5-7,9H2,1H3;1H/t12-,14-;/m0./s1 |
| Inchi Key | DCFXOTRONMKUJB-KYSPHBLOSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/pd-128907-hydrochloride-cas-300576-59-4-item-105203.html |
