(+/-)-Imazalil-[d5] Sulfate
(+/-)-Imazalil-[d5] Sulfate, is the labelled analogue of Imazalil. Imazalil, is a fungicide widely used in agriculture, particularly in the growing of citrus fruits.
| Catalog Number | 1398065-92-3 |
| Alternative Name(s) | Imazalil-d5 Sulfate; 1-[2-(2,4-Dichlorophenyl)-2-[2-(propen-1-yl-d5)oxy]ethyl]-1H-imidazole Sulfate; 1-[2-(2,4-Dichlorophenyl)-2-[2-(propenyl-d5)oxy]ethyl]-1H-imidazole Sulfate; Chloramizol-d5 Sulfate; Microban Additive IF 4-d5; R 27180-d5 |
| Molecular Formula | C14H11D5Cl2N2O5S |
| CAS# | 1398065-92-3 |
| Purity | 95% |
| Inchi | InChI=1S/C14H14Cl2N2O.H2O4S/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;1-5(2,3)4/h2-6,8,10,14H,1,7,9H2;(H2,1,2,3,4)/i1D2,2D,7D2; |
| Inchi Key | XVTXMTOYQVRHSK-XXANSLCBSA-N |
| Size | Please inquire |
| Supplier Page | https://isotope.bocsci.com/product/imazalil-d5-sulfate-cas-1398065-92-3-8050.html |
