(2S)-2-Hydroxyglutaric acid
(2S)-2-Hydroxyglutaric acid, an epigenetic modifier and putative oncometabolite of kidney cancer, inhibits histone demethylase, thereby promoting histone methylation. It inhibits mitochondrial creatine kinase (Mi-CK) activity with Km and Ki of 2.52 mM and 11.13 mM, respectively.
| Catalog Number | 13095-48-2 |
| Alternative Name(s) | (S)-2-Hydroxyglutaric acid; L-2-Hydroxyglutaric acid; (S)-α-Hydroxyglutaric Acid; L-alpha-Hydroxyglutaric acid; 2-hydroxy-L-Glutaric acid; 2-hydroxy-(S)-Pentanedioic acid; L-2-Hydroxyglutarate |
| Molecular Formula | C5H8O5 |
| CAS# | 13095-48-2 |
| Purity | ≥95% |
| Inchi | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| Inchi Key | HWXBTNAVRSUOJR-VKHMYHEASA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/2s-2-hydroxyglutaric-acid-cas-13095-48-2-item-163524.html |