(±)-Metanephrine-[d3] hydrochloride
(±)-Metanephrine-[d3] hydrochloride is the labelled analogue of (±)-Metanephrine hydrochloride, which is a metabolite of Epinephrine. Epinephrine is a natural neurotransmitter that is released from the adrenal medulla and activates adrenoceptors.
| Catalog Number | 1215507-88-2 |
| Alternative Name(s) | (±)-metanephrine-d3 HCl; (±)-Metanephrine-d3 Hydrochloride; 3-Methoxyadrenaline-d3 Hydrochloride; 3-O-Methylepinephrine-d3 Hydrochloride; a-[(Methylamino-d3)methyl]-vanillyl Alcohol Hydrochloride; rac Metanephrine-d3 Hydrochloride Salt; 4-Hydroxy-3-Methoxy-α-[(Methylamino-d3)Methyl]benzenemethanol Hydrochloride |
| Molecular Formula | C10H12D3NO3.HCl |
| CAS# | 1215507-88-2 |
| Purity | >97% |
| Inchi | InChI=1S/C10H15NO3.ClH/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2;/h3-5,9,11-13H,6H2,1-2H3;1H/i1D3; |
| Inchi Key | HRIQFVCFOPJYEQ-NIIDSAIPSA-N |
| Size | Please inquire |
| Supplier Page | https://isotope.bocsci.com/product/metanephrine-d3-hydrochloride-cas-1215507-88-2-307270.html |