(+)-Blebbistatin
(+)-Blebbistatin is the inactive enantiomer of Blebbistatin, an inhibitor of myosin II ATPase. (+)-Blebbistatin can be used as a negative control of the active enatiomer (-)-Blebbistatin.
| Catalog Number | 1177356-70-5 |
| Alternative Name(s) | (R)-(+)-Blebbistatin; (3aR)-(+)-1,2,3,3a-Tetrahydro-3a-hydroxy-6-methyl-1-phenyl-4H-pyrrolo[2,3-b]quinolin-4-one |
| Molecular Formula | C18H16N2O2 |
| CAS# | 1177356-70-5 |
| Purity | ≥99% |
| Inchi | InChI=1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m0/s1 |
| Inchi Key | LZAXPYOBKSJSEX-SFHVURJKSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/blebbistatin-cas-1177356-70-5-item-311326.html |
