Tetradecanedioic acid
Tetradecanedioic acid is an alpha,omega-dicarboxylic acid that is tetradecane in which the methyl groups have been oxidised to the corresponding carboxylic acids. It has a role as a human metabolite. It is a conjugate acid of a tetradecanedioate(2-). It derives from a hydride of a tetradecane.
| Catalog Number | R1940 |
| Molecular Formula | C14H26O4 |
| CAS# | 821-38-5 |
| Purity | >95% |
| Inchi | InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| Inchi Key | HQHCYKULIHKCEB-UHFFFAOYSA-N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/tetradecanedioic-acid-item-r1940-39657.html |
