Dodecanedioic acid
Dodecanedioic acid informally referred to as DDDA is a saturated aliphatic dicarboxylic acid mainly used in antiseptics, top-grade coatings, painting materials, corrosion inhibitor, surfactant, and plastics. Experimental work with Dodecanedioic acid in type 2 diabetic patients has demonstrated that IV infusion helps to maintain normal blood sugar and energy levels without increasing the blood glucose load in the process.
Catalog Number | R1938 |
Alternative Name(s) | 1,12-Dodecanedioic acid, 1,10-Decanedicarboxylic acid, Decamethylenedicarboxylic acid |
Molecular Formula | C12H22O4 |
CAS# | 693-23-2 |
Purity | >95% |
Inchi | InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) |
Inchi Key | TVIDDXQYHWJXFK-UHFFFAOYSA-N |
Size | Inquiry |
Supplier Page | https://www.creative-peptides.com/product/dodecanedioic-acid-item-r1938-39655.html |