Polyoxin d
Polyoxin d is a member of the class of polyoxins that is isolated from the soil organism Streptomyces cacaoi var. asoensis. Polyoxin d exhibits fungicidal properties and may be used on rice, industrial grounds, golf courses and parks. It has a role as an EC 2.4.1.16 (chitin synthase) inhibitor and an antifungal agrochemical.
| Catalog Number | MFP-073 |
| Alternative Name(s) | Polyoxorim, Polyoxin Z, 22976-86-9, UNII-A2468O1N7D |
| Molecular Formula | C17H23N5O14 |
| CAS# | 22976-86-9 |
| Purity | >95% |
| Inchi | InChI=1S/C17H23N5O14/c18-5(7(24)4(23)2-35-16(19)33)12(28)20-6(15(31)32)10-8(25)9(26)13(36-10)22-1-3(14(29)30)11(27)21-17(22)34/h1,4-10,13,23-26H,2,18H2,(H2,19,33)(H,20,28)(H,29,30)(H,31,32)(H,21,27,34)/t4-,5-,6-,7+,8-,9+,10+,13+/m0/s1 |
| Inchi Key | JPFWJDMDPLEUBD-ITJAGOAWSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)[C@@H](C(=O)O)NC(=O)[C@H]([C@@H]([C@H](COC(=O)N)O)O)N)O)O)C(=O)O |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/polyoxin-d-item-mfp-073-40628.html |