Epothilone B
Epothilone B is an epithilone that is epithilone D in which the double bond in the macrocyclic ring has been oxidised to the corresponding epoxide (the S,S stereoisomer). It has a role as an apoptosis inducer, an antineoplastic agent and a microtubule-stabilising agent.
Catalog Number | MFP-028 |
Alternative Name(s) | Patupilone, (-)-Epothilone B, Epo B |
Molecular Formula | C27H41NO6S |
CAS# | 152044-54-7 |
Purity | >95% |
Inchi | InChI=1S/C27H41NO6S/c1-15-9-8-10-27(7)22(34-27)12-20(16(2)11-19-14-35-18(4)28-19)33-23(30)13-21(29)26(5,6)25(32)17(3)24(15)31/h11,14-15,17,20-22,24,29,31H,8-10,12-13H2,1-7H3/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
Inchi Key | QXRSDHAAWVKZLJ-PVYNADRNSA-N |
SMILES | C[C@H]1CCC[C@@]2([C@@H](O2)C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C3=CSC(=N3)C)/C)C |
Size | Inquiry |
Supplier Page | https://www.creative-peptides.com/product/epothilone-b-item-mfp-028-40605.html |