K 252a
K 252a is a organic heterooctacyclic compound that is a potent inhibitor of protein kinase C and is isolated from Nocardiopsis sp K-252a It has a role as an EC 2.7.11.13 (protein kinase C) inhibitor, an antimicrobial agent, a tropomyosin-related kinase B receptor antagonist and a bacterial metabolite.
| Catalog Number | MFP-012 |
| Alternative Name(s) | k-252a, Antibiotic K 252a, K252a, Antibiotic SF 2370, SF 2370 |
| Molecular Formula | C27H21N3O5 |
| CAS# | 99533-80-9 |
| Purity | >95% |
| Inchi | InChI=1S/C27H21N3O5/c1-26-27(33,25(32)34-2)11-18(35-26)29-16-9-5-3-7-13(16)20-21-15(12-28-24(21)31)19-14-8-4-6-10-17(14)30(26)23(19)22(20)29/h3-10,18,33H,11-12H2,1-2H3,(H,28,31)/t18-,26+,27+/m1/s1 |
| Inchi Key | KOZFSFOOLUUIGY-SOLYNIJKSA-N |
| SMILES | C[C@@]12[C@](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)OC)O |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/k-252a-item-mfp-012-40644.html |