Leptomycin B
Leptomycin B is a leptomycin having a (2E,10E,12E,16Z,18E)-double bond configuration as well as an ethyl substituent at position 17. It has a role as an antifungal agent and a bacterial metabolite. It is a leptomycin and a hydroxy polyunsaturated fatty acid. It derives from a tetracosanoic acid.
Catalog Number | MFP-006 |
Alternative Name(s) | Elactocin, Mantuamycin, Antibiotic CI 940 |
Molecular Formula | C33H48O6 |
CAS# | 87081-35-4 |
Purity | >95% |
Inchi | InChI=1S/C33H48O6/c1-9-28(14-15-29-24(5)13-16-31(36)39-29)19-22(3)12-10-11-21(2)17-25(6)32(37)27(8)33(38)26(7)18-23(4)20-30(34)35/h10-11,13-17,19-20,22,24-27,29,33,38H,9,12,18H2,1-8H3,(H,34,35)/b11-10+,15-14+,21-17+,23-20+,28-19-/t22-,24+,25-,26+,27-,29+,33-/m1/s1 |
Inchi Key | YACHGFWEQXFSBS-XYERBDPFSA-N |
SMILES | CC/C(=C/[C@H](C)C/C=C/C(=C/[C@@H](C)C(=O)[C@@H](C)[C@@H]([C@@H](C)C/C(=C/C(=O)O)/C)O)/C)/C=C/[C@H]1[C@H](C=CC(=O)O1)C |
Size | Inquiry |
Supplier Page | https://www.creative-peptides.com/product/leptomycin-b-item-mfp-006-40638.html |