Cyclosporin A
Cyclosporin A is a cyclic undecapeptide from an extract of soil fungi. It is a powerful immunosupressant with a specific action on T-lymphocytes. It can bind to the cyclophilin and then inhibits calcineurin. Thus, it is widely used in organ transplantation to prevent rejection.
| Catalog Number | 10-101-77 |
| Alternative Name(s) | Cyclosporine, Ciclosporin, Cyclosporin, Cyclosporin A, Cyclosporine A, Neoral, OL 27-400, Restasis, Sandimmun, Sandimmune |
| Research Area | For prevention or treatment of organ (kidney, liver, and heart) transplant and tissue transplant rejection, rheumatoid arthritis, severe psoriasis. |
| Molecular Formula | C62H111N11O12 |
| CAS# | 59865-13-3 |
| Purity | >98% |
| Inchi | InChI=1S/C62H111N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h25,27,34-47,49-52,75H,26,28-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50+,51+,52-/m1/s1 |
| Inchi Key | PMATZTZNYRCHOR-CGLBZJNRSA-N |
| SMILES | CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/cyclosporin-a-item-10-101-77-31.html |