CCK-4 Acetate
Cholecystokinin tetrapeptide (CCK-4, also PTK7) is a peptide fragment derived from the larger peptide hormone cholecystokinin. CCK-4 acts primarily in the brain as an anxiogenic, although it does retain some GI effects, but not as much as CCK-8 or the full length polypeptide CCK-58.
| Catalog Number | 10-101-74 |
| Alternative Name(s) | CCK-4, CCK4, CCK 4, Gastrin Tetrapeptide, Cholecystokinin Octapeptide (5-8), Cholecystokinin Tetrapeptide, Gastrin (14-17) (human) |
| Research Area | CCK-4 acts primarily in the brain as an anxiogenic. It is commonly used in scientific research to induce panic attacks for the purpose of testing new anxiolytic drugs. |
| Molecular Formula | C29H36N6O6S |
| CAS# | 35144-91-3 |
| Purity | >95% |
| Inchi | InChI=1S/C29H36N6O6S/c1-42-12-11-22(33-27(39)20(30)14-18-16-32-21-10-6-5-9-19(18)21)28(40)35-24(15-25(36)37)29(41)34-23(26(31)38)13-17-7-3-2-4-8-17/h2-10,16,20,22-24,32H,11-15,30H2,1H3,(H2,31,38)(H,33,39)(H,34,41)(H,35,40)(H,36,37)/t20-,22-,23-,24-/m0/s1 |
| Inchi Key | RGYLYUZOGHTBRF-BIHRQFPBSA-N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/cck-4-acetate-item-10-101-74-27.html |
