Montirelin
Montirelin stimulates the release of thyrotropin and prolactin. It is synthesized by the neurons in the paraventricular nucleus of the hypothalamus. After being released into the pituitary portal circulation, TRH (was called TRF) stimulates the release of TSH and PRL from the anterior pituitary gland.
| Catalog Number | 10-101-64 |
| Alternative Name(s) | CG 3703, CG-3703, CG3703, CNK 602A, CNK602A, CNK-602A, CNK 603, CNK603, CNK-603, NS-3, NS3, NS 3, PS 24, Montirelin, Montireline, Montirelinum, Montirelin, Montirelina, CCRIS 7571, CCRIS7571 |
| Research Area | Montirelin is a potent, biologically stable TRH analog for brain receptor binding. |
| Molecular Formula | C17H24N6O4S |
| CAS# | 62305-91-3 |
| Purity | >95% |
| Inchi | InChI=1S/C17H24N6O4S/c1-9-15(25)22-12(7-28-9)16(26)21-11(5-10-6-19-8-20-10)17(27)23-4-2-3-13(23)14(18)24/h6,8-9,11-13H,2-5,7H2,1H3,(H2,18,24)(H,19,20)(H,21,26)(H,22,25)/t9?,11-,12?,13-/m0/s1 |
| Inchi Key | RSHMQGIMHQPMEB-VEEXIGFHSA-N |
| SMILES | CC1C(=O)NC(CS1)C(=O)N[C@@H](CC2=CN=CN2)C(=O)N3CCC[C@H]3C(=O)N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/montirelin-item-10-101-64-75.html |