Darifenacin Hydrobromide
Darifenacin hydrobromide is used to treat people who have urinary problems such as urinary incontinence, urinary urgency or urinary frequency which are caused by an overactive bladder. It works by preventing spasms of the bladder muscle. This can help to reduce the episodes of urinary incontinence, the frequency of urination or reduce the feeling of urgency that bladder spasms can cause.
| Catalog Number | 10-101-114 |
| Alternative Name(s) | 2-[(3S)-1-[2-(2,3-Dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide hydrobromide |
| Research Area | Overactive bladder |
| Molecular Formula | C28H31BrN2O |
| CAS# | 133099-07-7 |
| Purity | >95% |
| Inchi | InChI=1S/C28H30N2O2.BrH/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26;/h1-12,19,25H,13-18,20H2,(H2,29,31);1H/t25-;/m1./s1 |
| Inchi Key | UQAVIASOPREUIT-VQIWEWKSSA-N |
| SMILES | C1CN(C[C@@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)N)CCC4=CC5=C(C=C4)OCC5.Br |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/darifenacin-hydrobromide-item-10-101-114-35.html |
