Aftin-4
A Roscovitine-related purine derivative that selectively and potently increases the production of extracellular Aβ42 and decreases the production of extracellular Aβ38 in cultured cells.
| Trivial name | Aftin-4 (RE1036) |
| Catalog Number | RE1036 |
| Alternative Name(s) | N6-Methyl-(R)-roscovitine; Amyloid-β Forty-Two Inducer 4 |
| Research Area | Other/Reagents |
| Molecular Formula | C₂₀H₂₈N₆O |
| Inchi | InChI=1S/C20H28N6O/c1-5-16(12-27)22-20-23-18(25(4)11-15-9-7-6-8-10-15)17-19(24-20)26(13-21-17)14(2)3/h6-10,13-14,16,27H,5,11-12H2,1-4H3,(H,22,23,24)/t16-/m1/s1 |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/aftin-4-item-607.html |
| Additional Information | Appearance:White to off-white solid |
