3-Bromopyruvic acid
3-Bromopyruvic acid is a hexokinase inhibitor that has been shown to abolish ATP production and cause severe depletion of cellular ATP. It displays potent cytotoxic activity against cancer cells with mitochondrial respiratory defects and cells in a hypoxic environment.
| Trivial name | 3-Bromopyruvic acid (RE1019) |
| Catalog Number | RE1019 |
| Alternative Name(s) | 3-Bromo-2-oxopropionic acid; 3-BrPA |
| Research Area | Other/Reagents |
| Molecular Formula | C₃H₃BrO₃ |
| Inchi | InChI=1S/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/3-bromopyruvic-acid-item-590.html |
| Additional Information | Appearance:White solid |