IPAM
A cell-permeable indole derivative that acts as an antioxidant and mitochondrial metabolism modifier. IPAM binds to the rate-limiting component of oxidative phosphorylation in complex I of the respiratory chain and acts as a stabilizer of energy metabolism, thereby reducing the production of reactive oxygen species.
| Trivial name | IPAM (RE1016) |
| Catalog Number | RE1016 |
| Alternative Name(s) | Indole 3-propionamide |
| Research Area | Other/Reagents |
| Molecular Formula | C₁₁H₁₂N₂O |
| Inchi | InChI=1S/C11H12N2O/c12-11(14)6-5-8-7-13-10-4-2-1-3-9(8)10/h1-4,7,13H,5-6H2,(H2,12,14) |
| Size | 10mg |
| Supplier Page | https://www.mitochondriasci.com/ipam-item-587.html |
| Additional Information | Appearance:White solid |
