Osimertinib (AZD9291)
Osimertinib (AZD9291) is an oral, irreversible, and mutant-selective EGFR inhibitor with IC50 of 12.92, 11.44 and 493.8 nM for Exon 19 deletion EGFR, L858R/T790M EGFR, and WT EGFR in LoVo cells, respectively. Phase 3.
| Trivial name | Mereletinib |
| Catalog Number | S7297 |
| Molecular Formula | C28 H33 N7 O2 |
| CAS# | 1421373-65-0 |
| Inchi | InChI=1S/C28H33N7O2/c1-7-27(36)30-22-16-23(26(37-6)17-25(22)34(4)15-14-33(2)3)32-28-29-13-12-21(31-28)20-18-35(5)24-11-9-8-10-19(20)24/h7-13,16-18H,1,14-15H2,2-6H3,(H,30,36)(H,29,31,32) |
| Inchi Key | DUYJMQONPNNFPI-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(C=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OC |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/azd9291.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AZD9291-chemical-structure-s7297.gif |