Eflornithine (DFMO) hydrochloride hydrate
Eflornithine (DFMO) hydrochloride hydrate inhibits polyamine biosynthesis by the selective, irreversible inhibition of ornithine decarboxylase (ODC). A chemoprotective agent that blocks angiogenesis. Its biological half-life is 8 hours.
| Trivial name | Difluoromethylornithine hydrochloride hydrate, MDL-71782 hydrochloride hydrate, RMI-71782 hydrochloride hydrate, α-difluoromethylornithine hydrochloride hydrate |
| Catalog Number | S4582 |
| Molecular Formula | C6H12F2N2O2.HCl.H2O |
| CAS# | 96020-91-6 |
| Inchi | InChI=1S/C6H12F2N2O2.ClH.H2O/c7-4(8)6(10,5(11)12)2-1-3-9;;/h4H,1-3,9-10H2,(H,11,12);1H;1H2 |
| Inchi Key | FJPAMFNRCFEGSD-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)F)(C(=O)O)N)CN.O.Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/eflornithine-hydrochloride-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/eflornithine-hydrochloride-hydrate-chemical-structure-s4582.gif |