L-Histidine monohydrochloride monohydrate
L-Histidine monohydrochloride monohydrate (L-Histidine hydrochloride hydrate, H-His-OH.HCl.H2O), a structural analogue of the essential amino acid L-histidine, is a reversible inhibitor of protein biosynthesis which evokes disparate responses from non-tumorigenic and tumorigenic cells in culture.
| Trivial name | L-Histidine hydrochloride hydrate, H-His-OH.HCl.H2O |
| Catalog Number | S3096 |
| Molecular Formula | C6H12ClN3O3 |
| CAS# | 5934-29-2 |
| SMILES | O.Cl.NC(CC1=CN=C[NH]1)C(O)=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/l-histidine-monohydrochloride-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3096-l-histidine-hydrochloride-monohydrate-chemical-structure.gif |