SC79 25mg
SC79 is an AKT activator. SC79 binds to the plecktrin homology (PH) domain of Akt that mimics the binding of PtdIns(3,4,5)P3 to induce a conformational change in Akt that enhances phosphorylation and activation.
| Trivial name | SC79 25mg |
| Catalog Number | A15541-25 |
| Alternative Name(s) | 2-Amino-6-chloro-??-cyano-3-(ethoxyca??rbonyl)-4H-1-benzopyran-4-acetic acid ethyl ester |
| Molecular Formula | C17H17ClN2O5 |
| CAS# | 305834-79-1 |
| SMILES | ClC1=CC=C(OC(N)=C(C(OCC)=O)C2C(C#N)C(OCC)=O)C2=C1 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/sc79.html |
