TAS-102 5mg
TAS-102 is an orally bioavailable combination agent composed of the cytotoxic pyrimidine analog Trifluridine (5-trifluoro-2??-deoxythymidine or TFT) and a thymidine phosphorylase inhibitor (TPI) tipiracil hydrochloride, in a molar ratio of 1.0:0.5 (TFT:TPI), with potential antineoplastic activity. TAS102= Trifluridine and tipiracil HCl (molar ratio = 1.0 : 0.5 or 2:1)
| Trivial name | TAS-102 5mg |
| Catalog Number | A15533-5 |
| Alternative Name(s) | N/A |
| Molecular Formula | C29H34Cl2F6N8O12 |
| CAS# | 733030-01-8 |
| SMILES | O=C1NC(C(C(F)(F)F)=CN1[C@@H]2O[C@H](CO)[C@@H](O)C2)=O.O=C3NC(C(Cl)=C(CN4C(CCC4)=N)N3)=O.[H]Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tas-102.html |
