Fumonisin B1 25mg
Fumonisin B1 is a fungal metabolite produced by Fusarium moniliforme, that has been shown to inhibit protein serine/threonine phosphatases (PP1, PP2A, PP2B, PP2C, and PP5/T/K/H), and is most effective with PP5.
| Trivial name | Fumonisin B1 25mg |
| Catalog Number | A15379-25 |
| Alternative Name(s) | (2R,2'R)-1,2,3-Propanetricarboxylic acid 1,1'-[(1S,2R)-1-[(2S,4R,9R,11S,12S)-12-amino-4,9,11-trihydroxy-2-methyltridecyl]-2-[(1R)-1-methylpentyl]-1,2-ethanediyl] ester |
| Molecular Formula | C34H59NO15 |
| CAS# | 116355-83-0 |
| SMILES | CCCCC(C)C(C(CC(C)CC(CCCCC(CC(C(C)N)O)O)O)OC(=O)CC(CC(=O)O)C(=O)O)OC(=O)CC(CC(=O)O)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/fumonisin-b1.html |
