SJ 172550 10mg
SJ 172550 is the first MDMX inhibitor with EC50 of 0.84 uM; binds reversibly to MDMX and effectively kills retinoblastoma cells in which the expression of MDMX is amplified.
| Trivial name | SJ 172550 10mg |
| Catalog Number | A15352-10 |
| Alternative Name(s) | methyl 2-[2-chloro-6-ethoxy-4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate |
| Molecular Formula | C22H21ClN2O5 |
| CAS# | 431979-47-4 |
| SMILES | CCOC1=C(C(=CC(=C1)C=C2C(=NN(C2=O)C3=CC=CC=C3)C)Cl)OCC(=O)OC |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sj-172550.html |
