Bax inhibitor peptide P5 10mg
Bax inhibitor peptide P5, cell-permeable synthetic peptide inhibitor of Bax translocation to mitochondria; designed from Ku70, a protein that is suggested to suppress the mitochondrial translocation of Bax. Inhibits Bax-mediated apoptosis in vitro.
| Trivial name | Bax inhibitor peptide P5 10mg |
| Catalog Number | A15336-10 |
| Alternative Name(s) | (2S)-2-[[(2S)-6-amino-2-[[(2S)-4-methyl-2-[[(2S)-4-methylsulfanyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoyl]amino]pentanoyl]amino]hexanoyl]amino]pentanedioic acid |
| Molecular Formula | C27H48N6O8S |
| CAS# | 579492-83-4 |
| SMILES | CC(C)CC(C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O)NC(=O)C(CCSC)NC(=O)C1CCCN1 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bax-inhibitor-peptide-p5.html |
