BC 11 hydrobromide 10mg
BC 11 hydrobromide, belective urokinase (uPA) inhibitor (IC50 = 8.2 ??M). Inhibits clot lysis with no effect on clot formation and exhibits no activity at 8 other uPA related enzymes.
| Trivial name | BC 11 hydrobromide 10mg |
| Catalog Number | A15325-10 |
| Alternative Name(s) | (4-((carbamimidoylthio)methyl)phenyl)boronic acid hydrobromide |
| Molecular Formula | C8H11BN2O2S.HBr |
| CAS# | 443776-49-6 |
| SMILES | B(C1=CC=C(C=C1)CSC(=N)N)(O)O.Br |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bc-11-hydrobromide.html |