PD 150606 5mg
PD 150606 is a cell-permeable, non-competitive, selective, non-peptide Ca2+ dependent calpain inhibitor for calpain-1 and for calpain-2 directed towards the Ca2+ binding sites of calpain.
| Trivial name | PD 150606 5mg |
| Catalog Number | A15306-5 |
| Alternative Name(s) | (Z)-3-(4-iodophenyl)-2-sulfanylprop-2-enoic acid |
| Molecular Formula | C9H7IO2S |
| CAS# | 179528-45-1 |
| SMILES | C1=CC(=CC=C1C=C(C(=O)O)S)I |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/pd-150606.html |
