DPPI 1c hydrochloride 1mg
DPPI 1c hydrochloride is a dicyanopyrrolidine compound that acts as a slow-binding and active site-targeting inhibitor of CD26 (DPP 4), with an IC50 = 106 nM and little activity against DPP II, DPP III, DPP VIII, DPP IX, FAP, or APP even at concentrations as high as 30 ??M.
| Trivial name | DPPI 1c hydrochloride 1mg |
| Catalog Number | A15298-1 |
| Alternative Name(s) | (2S,5R)-1-(2-((1-(hydroxymethyl)cyclopentyl)amino)acetyl)pyrrolidine-2,5-dicarbonitrile hydrochloride |
| Molecular Formula | C14H20N4O2.HCl |
| CAS# | 866396-34-1 |
| SMILES | C1CCC(C1)(CO)NCC(=O)N2C(CCC2C#N)C#N.Cl |
| Size | 1mg |
| Supplier Page | http://www.adooq.com/dppi-1c-hydrochloride.html |
