TG 100572 Hydrochloride 10mg
TG 100572 is a multi-targeted kinase inhibitor that inhibit select growth factor receptor tyrosine kinases and Src familt kinases with IC50 values of 2/7/2/1/0.5 nM for VEGFR1/VEGFR2/FGFR1/Src/Fyn kianse respectively.
| Trivial name | TG 100572 Hydrochloride 10mg |
| Catalog Number | A15260-10 |
| Alternative Name(s) | 4-chloro-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenol;hydrochloride |
| Molecular Formula | C26H27Cl2N5O2 |
| CAS# | 867331-64-4 |
| SMILES | CC1=C2C(=CC(=C1)C3=C(C=CC(=C3)O)Cl)N=NC(=N2)NC4=CC=C(C=C4)OCCN5CCCC5.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/tg-100572-hydrochloride.html |
