Tanaproget 5mg
Tanaproget is a novel nonsteroidal progesterone receptor agonist which can bind to the PR from various species with a higher relative affinity than reference steroidal progestins.
Trivial name | Tanaproget 5mg |
Catalog Number | A15256-5 |
Alternative Name(s) | 5-(4,4-dimethyl-2-sulfanylidene-1H-3,1-benzoxazin-6-yl)-1-methylpyrrole-2-carbonitrile |
Molecular Formula | C₁₆H₁₅N₃OS |
CAS# | 304853-42-7 |
SMILES | CC1(C2=C(C=CC(=C2)C3=CC=C(N3C)C#N)NC(=S)O1)C |
Size | 5mg |
Supplier Page | http://www.adooq.com/tanaproget.html |