Tanaproget 25mg
Tanaproget is a novel nonsteroidal progesterone receptor agonist which can bind to the PR from various species with a higher relative affinity than reference steroidal progestins.
| Trivial name | Tanaproget 25mg |
| Catalog Number | A15256-25 |
| Alternative Name(s) | 5-(4,4-dimethyl-2-sulfanylidene-1H-3,1-benzoxazin-6-yl)-1-methylpyrrole-2-carbonitrile |
| Molecular Formula | C16H15N3OS |
| CAS# | 304853-42-7 |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CC=C(N3C)C#N)NC(=S)O1)C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/tanaproget.html |
