Talnetant hydrochloride 50mg
Talnetant Hcl is a potent and selective NK3 receptor antagonist(ki=1.4 nM, hNK-3-CHO); 100-fold selective for the hNK-3 versus hNK-2 receptor, with no affinity for the hNK-1 at concentrations up to 100 uM.
| Trivial name | Talnetant hydrochloride 50mg |
| Catalog Number | A15255-50 |
| Alternative Name(s) | 3-hydroxy-2-phenyl-N-(1-phenylpropyl)quinoline-4-carboxamide;hydrochloride |
| Molecular Formula | C25H23ClN2O2 |
| CAS# | 204519-66-4 |
| SMILES | CCC(C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)O.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/talnetant-hydrochloride.html |
