TAK-242 S enantiomer 200mg
S enantiomer of TAK-242. TAK-242 (Resatorvid), a small-molecule inhibitor of Toll-like receptor (TLR) 4 signaling. TAK-242 is in treatment of sepsis and septic shock.
| Trivial name | TAK-242 S enantiomer 200mg |
| Catalog Number | A15253-200 |
| Alternative Name(s) | ethyl (6S)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| Molecular Formula | C15H17ClFNO4S |
| CAS# | 243984-10-3 |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)NC2=C(C=C(C=C2)F)Cl |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/tak-242-s-enantiomer.html |