SB-408124 Hydrochloride 250mg
SB408124 Hcl is a non-peptide antagonist for OX1 receptor with Ki of 57 nM and 27 nM in both whole cell and membrane, respectively; exhibits 50-fold selectivity over OX2 receptor.
| Trivial name | SB-408124 Hydrochloride 250mg |
| Catalog Number | A15231-250 |
| Alternative Name(s) | N-(6,8-Difluoro-2-methyl-4-quinolinyl)-N'-[4-(dimethylamino)phenyl]urea hydrochloride (1:1) |
| Molecular Formula | C19H19ClF2N4O |
| CAS# | 1431697-90-3 |
| SMILES | CCC(C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)C |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/sb-408124-hydrochloride.html |
