Regorafenib monohydrate 50mg
Regorafenib is a multi-target inhibitor for VEGFR1, VEGFR2, VEGFR3, PDGFR??, Kit, RET and Raf-1 with IC50 of 13 nM/4.2 nM/46 nM, 22 nM, 7 nM, 1.5 nM and 2.5 nM, respectively.
| Trivial name | Regorafenib monohydrate 50mg |
| Catalog Number | A15218-50 |
| Alternative Name(s) | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate |
| Molecular Formula | C21H17ClF4N4O4 |
| CAS# | 1019206-88-2 |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F.O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/regorafenib-monohydrate.html |
