PI-103 Hydrochloride 50mg
PI103 is a potent inhibitor with low IC50 values against recombinant PI3K isoforms p110alpha (IC50= 2 nM), p110beta (IC50= 3 nM), p110delta (IC50= 3 nM), and p110gamma (IC50= 15 nM), less potent to mTOR/DNA-PK with IC50 of 30 nM/23 nM.
| Trivial name | PI-103 Hydrochloride 50mg |
| Catalog Number | A15212-50 |
| Alternative Name(s) | 3-(4-morpholin-4-ylpyrido[2,3]furo[2,4-b]pyrimidin-2-yl)phenol;hydrochloride |
| Molecular Formula | C19H17ClN4O3 |
| CAS# | 371935-79-4 |
| SMILES | C1COCCN1C2=NC(=NC3=C2OC4=C3C=CC=N4)C5=CC(=CC=C5)O.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/pi-103-hydrochloride.html |