Phenylpiracetam 5mg
Phenylpiracetam is a phenylated derivative of the nootropic drug piracetam. It is used as a stimulant nootropic drug that can be up to 30-60 times more potent than piracetam.
| Trivial name | Phenylpiracetam 5mg |
| Catalog Number | A15211-5 |
| Alternative Name(s) | 2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide |
| Molecular Formula | C12H14N2O2 |
| CAS# | 77472-70-9 |
| SMILES | C1C(CN(C1=O)CC(=O)N)C2=CC=CC=C2 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/phenylpiracetam.html |