PF-543 Citrate 5mg
PF-543 Citrate is a novel cell-permeant inhibitor of SphK1 with a K(i) of 3.6 nM, PF-543 is sphingosine-competitive and is more than 100-fold selective for SphK1 over the SphK2 isoform.
| Trivial name | PF-543 Citrate 5mg |
| Catalog Number | A15210-5 |
| Alternative Name(s) | [(2R)-1-[[4-[[3-(benzenesulfonylmethyl)-5-methylphenoxy]methyl]phenyl]methyl]pyrrolidin-2-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| Molecular Formula | C33H39NO11S |
| CAS# | 1415562-83-2 |
| SMILES | CC1=CC(=CC(=C1)OCC2=CC=C(C=C2)CN3CCCC3CO)CS(=O)(=O)C4=CC=CC=C4.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/pf-543-citrate.html |
