NKP608 10mg
NKP608 is a non-peptidic derivative of 4-aminopiperidine which acts as a selective, specific and potent antagonist at the neurokinin-1 (NK-1) receptor both in vitro(IC50=2.6 nM) and in vivo.
| Trivial name | NKP608 10mg |
| Catalog Number | A15187-10 |
| Alternative Name(s) | N-[(2R,4S)-1-[3,5-bis(trifluoromethyl)benzoyl]-2-[(4-chlorophenyl)methyl]piperidin-4-yl]quinoline-4-carboxamide |
| Molecular Formula | C31H24ClF6N3O2 |
| CAS# | 177707-12-9 |
| SMILES | C1CN(C(CC1NC(=O)C2=CC=NC3=CC=CC=C23)CC4=CC=C(C=C4)Cl)C(=O)C5=CC(=CC(=C5)C(F)(F)F)C(F)(F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/nkp608.html |
