KN-92 phosphate 10mg
KN-92 is an inactive derivative of KN-93. KN-93 is a selective inhibitor of Ca2+/calmodulin-dependent kinase II (CaMKII), competitively blocking CaM binding to the kinase (Ki = 370 nM).
| Trivial name | KN-92 phosphate 10mg |
| Catalog Number | A15139-10 |
| Alternative Name(s) | N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;phosphoric acid |
| Molecular Formula | C24H28ClN2O7PS |
| CAS# | 1135280-28-2 |
| SMILES | CN(CC=CC1=CC=C(C=C1)Cl)CC2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)OC.OP(=O)(O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/kn-92-phosphate.html |
